C30H40N9O4+ — CID 118953362
trimethyl-[(2S)-1-[2-[[(2S,3S)-3-methyl-2-[(2-phenylacetyl)amino]pentanoyl]amino]acetyl]-2-(2H-tetrazol-5-ylmethylcarbamoyl)-2,3-dihydroindol-5-yl]azanium (PubChem CID 118953362) has the molecular formula C30H40N9O4+ and a molecular weight of 590.71 g/mol. Its IUPAC name is trimethyl-[(2S)-1-[2-[[(2S,3S)-3-methyl-2-[(2-phenylacetyl)amino]pentanoyl]amino]acetyl]-2-(2H-tetrazol-5-ylmethylcarbamoyl)-2,3-dihydroindol-5-yl]azanium.
| Compound Name | trimethyl-[(2S)-1-[2-[[(2S,3S)-3-methyl-2-[(2-phenylacetyl)amino]pentanoyl]amino]acetyl]-2-(2H-tetrazol-5-ylmethylcarbamoyl)-2,3-dihydroindol-5-yl]azanium |
|---|---|
| PubChem CID | 118953362 |
| Molecular Formula | C30H40N9O4+ |
| Molecular Weight | 590.71 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | trimethyl-[(2S)-1-[2-[[(2S,3S)-3-methyl-2-[(2-phenylacetyl)amino]pentanoyl]amino]acetyl]-2-(2H-tetrazol-5-ylmethylcarbamoyl)-2,3-dihydroindol-5-yl]azanium |
| SMILES | CC[C@H](C)[C@H](NC(=O)Cc1ccccc1)C(=O)NCC(=O)N1c2ccc([N+](C)(C)C)cc2C[C@H]1C(=O)NCc1nn[nH]n1 |
| InChI | InChI=1S/C30H39N9O4/c1-6-19(2)28(33-26(40)14-20-10-8-7-9-11-20)30(43)32-18-27(41)38-23-13-12-22(39(3,4)5)15-21(23)16-24(38)29(42)31-17-25-34-36-37-35-25/h7-13,15,19,24,28H,6,14,16-18H2,1-5H3,(H3-,31,32,33,34,35,36,37,40,42,43)/p+1/t19-,24-,28-/m0/s1 |
| InChIKey | FVSDKBODFOYVPN-LLIYUYTPSA-O |
| XLogP | 0.86 |
| TPSA | 162.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.71 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|