About 6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-2-oxo-1H-quinoline-3-carbaldehyde
6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-2-oxo-1H-quinoline-3-carbaldehyde (PubChem CID 118953696) has the molecular formula C15H12ClF2NO3
and a molecular weight of 327.71 g/mol. Its IUPAC name is 6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-2-oxo-1H-quinoline-3-carbaldehyde.
Molecular Properties
| Compound Name | 6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-2-oxo-1H-quinoline-3-carbaldehyde |
| PubChem CID | 118953696 |
| Molecular Formula | C15H12ClF2NO3 |
| Molecular Weight | 327.71 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-2-oxo-1H-quinoline-3-carbaldehyde |
| SMILES | O=Cc1cc2cc(Cl)c(OCC3CC(F)(F)C3)cc2[nH]c1=O |
| InChI | InChI=1S/C15H12ClF2NO3/c16-11-2-9-1-10(6-20)14(21)19-12(9)3-13(11)22-7-8-4-15(17,18)5-8/h1-3,6,8H,4-5,7H2,(H,19,21) |
| InChIKey | ZGGWAVYGMPMZOC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.71 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-2-oxo-1H-quinoline-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-2-oxo-1H-quinoline-3-carbaldehyde?
The IUPAC name of 6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-2-oxo-1H-quinoline-3-carbaldehyde (CID 118953696) is 6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-2-oxo-1H-quinoline-3-carbaldehyde.
What is the SMILES notation for 6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-2-oxo-1H-quinoline-3-carbaldehyde?
The canonical SMILES for 6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-2-oxo-1H-quinoline-3-carbaldehyde is O=Cc1cc2cc(Cl)c(OCC3CC(F)(F)C3)cc2[nH]c1=O.
What is the InChIKey of 6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-2-oxo-1H-quinoline-3-carbaldehyde?
The InChIKey is ZGGWAVYGMPMZOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClF2NO3/c16-11-2-9-1-10(6-20)14(21)19-12(9)3-13(11)22-7-8-4-15(17,18)5-8/h1-3,6,8H,4-5,7H2,(H,19,21).
What are the key properties of 6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-2-oxo-1H-quinoline-3-carbaldehyde?
6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-2-oxo-1H-quinoline-3-carbaldehyde has a molecular weight of 327.71 g/mol, XLogP of 3.42, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-[(3,3-difluorocyclobutyl)methoxy]-2-oxo-1H-quinoline-3-carbaldehyde is sourced from PubChem (CID 118953696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).