C15H21N5O2 — CID 118954104
2-[4-(3-aminophenyl)triazol-1-yl]ethyl-tert-butylcarbamic acid (PubChem CID 118954104) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 2-[4-(3-aminophenyl)triazol-1-yl]ethyl-tert-butylcarbamic acid.
| Compound Name | 2-[4-(3-aminophenyl)triazol-1-yl]ethyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 118954104 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 2-[4-(3-aminophenyl)triazol-1-yl]ethyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(CCn1cc(-c2cccc(N)c2)nn1)C(=O)O |
| InChI | InChI=1S/C15H21N5O2/c1-15(2,3)20(14(21)22)8-7-19-10-13(17-18-19)11-5-4-6-12(16)9-11/h4-6,9-10H,7-8,16H2,1-3H3,(H,21,22) |
| InChIKey | YDUAOABIEYEYRT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|