C30H39N9O2 — CID 118954377
1-[[9-[1-amino-2-(2H-triazol-4-yl)pentoxy]-4-ethenyl-5-methyl-6H-phenanthridin-8-yl]oxy]-2-(2H-triazol-4-yl)pentan-1-amine (PubChem CID 118954377) has the molecular formula C30H39N9O2 and a molecular weight of 557.70 g/mol. Its IUPAC name is 1-[[9-[1-amino-2-(2H-triazol-4-yl)pentoxy]-4-ethenyl-5-methyl-6H-phenanthridin-8-yl]oxy]-2-(2H-triazol-4-yl)pentan-1-amine.
| Compound Name | 1-[[9-[1-amino-2-(2H-triazol-4-yl)pentoxy]-4-ethenyl-5-methyl-6H-phenanthridin-8-yl]oxy]-2-(2H-triazol-4-yl)pentan-1-amine |
|---|---|
| PubChem CID | 118954377 |
| Molecular Formula | C30H39N9O2 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.32 |
| IUPAC Name | 1-[[9-[1-amino-2-(2H-triazol-4-yl)pentoxy]-4-ethenyl-5-methyl-6H-phenanthridin-8-yl]oxy]-2-(2H-triazol-4-yl)pentan-1-amine |
| SMILES | C=Cc1cccc2c1N(C)Cc1cc(OC(N)C(CCC)c3cn[nH]n3)c(OC(N)C(CCC)c3cn[nH]n3)cc1-2 |
| InChI | InChI=1S/C30H39N9O2/c1-5-9-21(24-15-33-37-35-24)29(31)40-26-13-19-17-39(4)28-18(7-3)11-8-12-20(28)23(19)14-27(26)41-30(32)22(10-6-2)25-16-34-38-36-25/h7-8,11-16,21-22,29-30H,3,5-6,9-10,17,31-32H2,1-2,4H3,(H,33,35,37)(H,34,36,38) |
| InChIKey | CURKPLQLDYXBTC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 156.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|