C34H37NO6 — CID 118954387
8,9-bis[(2,3-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine (PubChem CID 118954387) has the molecular formula C34H37NO6 and a molecular weight of 555.67 g/mol. Its IUPAC name is 8,9-bis[(2,3-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine.
| Compound Name | 8,9-bis[(2,3-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine |
|---|---|
| PubChem CID | 118954387 |
| Molecular Formula | C34H37NO6 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 8,9-bis[(2,3-dimethoxyphenyl)methoxy]-4-ethyl-5-methyl-6H-phenanthridine |
| SMILES | CCc1cccc2c1N(C)Cc1cc(OCc3cccc(OC)c3OC)c(OCc3cccc(OC)c3OC)cc1-2 |
| InChI | InChI=1S/C34H37NO6/c1-7-22-11-8-14-26-27-18-31(41-21-24-13-10-16-29(37-4)34(24)39-6)30(17-25(27)19-35(2)32(22)26)40-20-23-12-9-15-28(36-3)33(23)38-5/h8-18H,7,19-21H2,1-6H3 |
| InChIKey | GRMMMVINVJDMDG-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |