About 2-benzylindazol-5-ol
2-benzylindazol-5-ol (PubChem CID 118954464) has the molecular formula C14H12N2O
and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-benzylindazol-5-ol.
Molecular Properties
| Compound Name | 2-benzylindazol-5-ol |
| PubChem CID | 118954464 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-benzylindazol-5-ol |
| SMILES | Oc1ccc2nn(Cc3ccccc3)cc2c1 |
| InChI | InChI=1S/C14H12N2O/c17-13-6-7-14-12(8-13)10-16(15-14)9-11-4-2-1-3-5-11/h1-8,10,17H,9H2 |
| InChIKey | NHHZQRJMNAGNNX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzylindazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylindazol-5-ol?
The IUPAC name of 2-benzylindazol-5-ol (CID 118954464) is 2-benzylindazol-5-ol.
What is the SMILES notation for 2-benzylindazol-5-ol?
The canonical SMILES for 2-benzylindazol-5-ol is Oc1ccc2nn(Cc3ccccc3)cc2c1.
What is the InChIKey of 2-benzylindazol-5-ol?
The InChIKey is NHHZQRJMNAGNNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O/c17-13-6-7-14-12(8-13)10-16(15-14)9-11-4-2-1-3-5-11/h1-8,10,17H,9H2.
What are the key properties of 2-benzylindazol-5-ol?
2-benzylindazol-5-ol has a molecular weight of 224.26 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylindazol-5-ol is sourced from PubChem (CID 118954464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).