C19H18N6O — CID 118955712
6,7-dimethyl-3-[[4-(tetrazol-1-yl)anilino]methyl]-1H-quinolin-2-one (PubChem CID 118955712) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is 6,7-dimethyl-3-[[4-(tetrazol-1-yl)anilino]methyl]-1H-quinolin-2-one.
| Compound Name | 6,7-dimethyl-3-[[4-(tetrazol-1-yl)anilino]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 118955712 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 6,7-dimethyl-3-[[4-(tetrazol-1-yl)anilino]methyl]-1H-quinolin-2-one |
| SMILES | Cc1cc2cc(CNc3ccc(-n4cnnn4)cc3)c(=O)[nH]c2cc1C |
| InChI | InChI=1S/C19H18N6O/c1-12-7-14-9-15(19(26)22-18(14)8-13(12)2)10-20-16-3-5-17(6-4-16)25-11-21-23-24-25/h3-9,11,20H,10H2,1-2H3,(H,22,26) |
| InChIKey | UNQLYSBMVVGBRH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |