C8H6F2N2O2 — CID 118956075
3-(4,6-difluoro-2-pyridinyl)-1,3-oxazolidin-2-one (PubChem CID 118956075) has the molecular formula C8H6F2N2O2 and a molecular weight of 200.14 g/mol. Its IUPAC name is 3-(4,6-difluoro-2-pyridinyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(4,6-difluoro-2-pyridinyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 118956075 |
| Molecular Formula | C8H6F2N2O2 |
| Molecular Weight | 200.14 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 3-(4,6-difluoro-2-pyridinyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1cc(F)cc(F)n1 |
| InChI | InChI=1S/C8H6F2N2O2/c9-5-3-6(10)11-7(4-5)12-1-2-14-8(12)13/h3-4H,1-2H2 |
| InChIKey | QYDXKRBIXHNWNA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.14 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|