C24H25FN4O2S — CID 118956598
N-[(4aR,7aS)-7a-(5-acetamido-2-fluorophenyl)-6-prop-2-enyl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 118956598) has the molecular formula C24H25FN4O2S and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[(4aR,7aS)-7a-(5-acetamido-2-fluorophenyl)-6-prop-2-enyl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[(4aR,7aS)-7a-(5-acetamido-2-fluorophenyl)-6-prop-2-enyl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 118956598 |
| Molecular Formula | C24H25FN4O2S |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-[(4aR,7aS)-7a-(5-acetamido-2-fluorophenyl)-6-prop-2-enyl-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | C=CCN1C[C@H]2CSC(NC(=O)c3ccccc3)=N[C@@]2(c2cc(NC(C)=O)ccc2F)C1 |
| InChI | InChI=1S/C24H25FN4O2S/c1-3-11-29-13-18-14-32-23(27-22(31)17-7-5-4-6-8-17)28-24(18,15-29)20-12-19(26-16(2)30)9-10-21(20)25/h3-10,12,18H,1,11,13-15H2,2H3,(H,26,30)(H,27,28,31)/t18-,24-/m0/s1 |
| InChIKey | GOGPZNVSRIJTRR-UUOWRZLLSA-N |
| XLogP | 3.63 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|