C22H24FN3OS — CID 118956636
N-[(4aR,7aS)-7a-(2-fluorophenyl)-6-prop-2-enyl-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 118956636) has the molecular formula C22H24FN3OS and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[(4aR,7aS)-7a-(2-fluorophenyl)-6-prop-2-enyl-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[(4aR,7aS)-7a-(2-fluorophenyl)-6-prop-2-enyl-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 118956636 |
| Molecular Formula | C22H24FN3OS |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | N-[(4aR,7aS)-7a-(2-fluorophenyl)-6-prop-2-enyl-1,2,4,4a,5,7-hexahydropyrrolo[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | C=CCN1C[C@H]2CSC(NC(=O)c3ccccc3)N[C@@]2(c2ccccc2F)C1 |
| InChI | InChI=1S/C22H24FN3OS/c1-2-12-26-13-17-14-28-21(24-20(27)16-8-4-3-5-9-16)25-22(17,15-26)18-10-6-7-11-19(18)23/h2-11,17,21,25H,1,12-15H2,(H,24,27)/t17-,21?,22-/m0/s1 |
| InChIKey | WZFFWJRXIDURCZ-OWHMDLSXSA-N |
| XLogP | 3.19 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|