C23H20BrF4N3O3 — CID 118956933
2-[(3S)-6-bromo-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide (PubChem CID 118956933) has the molecular formula C23H20BrF4N3O3 and a molecular weight of 542.33 g/mol. Its IUPAC name is 2-[(3S)-6-bromo-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide.
| Compound Name | 2-[(3S)-6-bromo-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
|---|---|
| PubChem CID | 118956933 |
| Molecular Formula | C23H20BrF4N3O3 |
| Molecular Weight | 542.33 g/mol |
| Exact Mass | 541.06 |
| IUPAC Name | 2-[(3S)-6-bromo-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(4-fluorophenyl)methyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
| SMILES | C[C@H](N(Cc1ccc(F)cc1)C(=O)CN1C(=O)N[C@]2(CCc3cc(Br)ccc32)C1=O)C(F)(F)F |
| InChI | InChI=1S/C23H20BrF4N3O3/c1-13(23(26,27)28)30(11-14-2-5-17(25)6-3-14)19(32)12-31-20(33)22(29-21(31)34)9-8-15-10-16(24)4-7-18(15)22/h2-7,10,13H,8-9,11-12H2,1H3,(H,29,34)/t13-,22-/m0/s1 |
| InChIKey | CCNZVLOMEWNHAL-XMHCIUCPSA-N |
| XLogP | 4.26 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|