C24H22F4N4O8S — CID 118956977
[(5R)-3-[2-[(4-fluorophenyl)methyl-[(2S)-1,1,1-trifluoropropan-2-yl]amino]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]carbamoylsulfamic acid (PubChem CID 118956977) has the molecular formula C24H22F4N4O8S and a molecular weight of 602.52 g/mol. Its IUPAC name is [(5R)-3-[2-[(4-fluorophenyl)methyl-[(2S)-1,1,1-trifluoropropan-2-yl]amino]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]carbamoylsulfamic acid.
| Compound Name | [(5R)-3-[2-[(4-fluorophenyl)methyl-[(2S)-1,1,1-trifluoropropan-2-yl]amino]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]carbamoylsulfamic acid |
|---|---|
| PubChem CID | 118956977 |
| Molecular Formula | C24H22F4N4O8S |
| Molecular Weight | 602.52 g/mol |
| Exact Mass | 602.11 |
| IUPAC Name | [(5R)-3-[2-[(4-fluorophenyl)methyl-[(2S)-1,1,1-trifluoropropan-2-yl]amino]-2-oxoethyl]-2,4-dioxospiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]carbamoylsulfamic acid |
| SMILES | C[C@H](N(Cc1ccc(F)cc1)C(=O)CN1C(=O)O[C@@]2(CCc3cc(NC(=O)NS(=O)(=O)O)ccc32)C1=O)C(F)(F)F |
| InChI | InChI=1S/C24H22F4N4O8S/c1-13(24(26,27)28)31(11-14-2-4-16(25)5-3-14)19(33)12-32-20(34)23(40-22(32)36)9-8-15-10-17(6-7-18(15)23)29-21(35)30-41(37,38)39/h2-7,10,13H,8-9,11-12H2,1H3,(H2,29,30,35)(H,37,38,39)/t13-,23+/m0/s1 |
| InChIKey | ADCJSCAVLQISKV-ZAMGYDSWSA-N |
| XLogP | 2.85 |
| TPSA | 162.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|