C23H21F4N3O4 — CID 118957066
N-[(4-fluorophenyl)methyl]-2-[(1R,3S)-1-hydroxy-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide (PubChem CID 118957066) has the molecular formula C23H21F4N3O4 and a molecular weight of 479.43 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[(1R,3S)-1-hydroxy-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[(1R,3S)-1-hydroxy-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
|---|---|
| PubChem CID | 118957066 |
| Molecular Formula | C23H21F4N3O4 |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[(1R,3S)-1-hydroxy-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
| SMILES | C[C@H](N(Cc1ccc(F)cc1)C(=O)CN1C(=O)N[C@]2(C[C@@H](O)c3ccccc32)C1=O)C(F)(F)F |
| InChI | InChI=1S/C23H21F4N3O4/c1-13(23(25,26)27)29(11-14-6-8-15(24)9-7-14)19(32)12-30-20(33)22(28-21(30)34)10-18(31)16-4-2-3-5-17(16)22/h2-9,13,18,31H,10-12H2,1H3,(H,28,34)/t13-,18+,22-/m0/s1 |
| InChIKey | PUGGSILZMRXDJT-CYYCYGDNSA-N |
| XLogP | 2.99 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|