C18H21FN4O3 — CID 11895710
(5S)-5-[[(1S,2R)-2-aminocyclohexyl]iminomethyl]-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 11895710) has the molecular formula C18H21FN4O3 and a molecular weight of 360.39 g/mol. Its IUPAC name is (5S)-5-[[(1S,2R)-2-aminocyclohexyl]iminomethyl]-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5S)-5-[[(1S,2R)-2-aminocyclohexyl]iminomethyl]-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 11895710 |
| Molecular Formula | C18H21FN4O3 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (5S)-5-[[(1S,2R)-2-aminocyclohexyl]iminomethyl]-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | N[C@@H]1CCCC[C@@H]1/N=C/[C@H]1C(=O)NC(=O)N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C18H21FN4O3/c19-12-7-5-11(6-8-12)10-23-17(25)13(16(24)22-18(23)26)9-21-15-4-2-1-3-14(15)20/h5-9,13-15H,1-4,10,20H2,(H,22,24,26)/b21-9+/t13-,14+,15-/m0/s1 |
| InChIKey | SQPAMQIUXQTAQR-DPECUYHKSA-N |
| XLogP | 1.36 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|