C21H31NO3 — CID 11895747
(1S,6S)-6-[[(1S)-1-(1-adamantyl)propyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 11895747) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is (1S,6S)-6-[[(1S)-1-(1-adamantyl)propyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6S)-6-[[(1S)-1-(1-adamantyl)propyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 11895747 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | (1S,6S)-6-[[(1S)-1-(1-adamantyl)propyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CC[C@H](NC(=O)[C@H]1CC=CC[C@@H]1C(=O)O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H31NO3/c1-2-18(21-10-13-7-14(11-21)9-15(8-13)12-21)22-19(23)16-5-3-4-6-17(16)20(24)25/h3-4,13-18H,2,5-12H2,1H3,(H,22,23)(H,24,25)/t13?,14?,15?,16-,17-,18-,21?/m0/s1 |
| InChIKey | XIKYNLRAQBQZED-BFRNDWSSSA-N |
| XLogP | 3.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|