C25H25F4N5O4 — CID 118957807
N-[(4-fluorophenyl)methyl]-2-[(3S)-6-(methylcarbamoylamino)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide (PubChem CID 118957807) has the molecular formula C25H25F4N5O4 and a molecular weight of 535.50 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[(3S)-6-(methylcarbamoylamino)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[(3S)-6-(methylcarbamoylamino)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
|---|---|
| PubChem CID | 118957807 |
| Molecular Formula | C25H25F4N5O4 |
| Molecular Weight | 535.50 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[(3S)-6-(methylcarbamoylamino)-2',5'-dioxospiro[1,2-dihydroindene-3,4'-imidazolidine]-1'-yl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
| SMILES | CNC(=O)Nc1ccc2c(c1)CC[C@]21NC(=O)N(CC(=O)N(Cc2ccc(F)cc2)[C@@H](C)C(F)(F)F)C1=O |
| InChI | InChI=1S/C25H25F4N5O4/c1-14(25(27,28)29)33(12-15-3-5-17(26)6-4-15)20(35)13-34-21(36)24(32-23(34)38)10-9-16-11-18(7-8-19(16)24)31-22(37)30-2/h3-8,11,14H,9-10,12-13H2,1-2H3,(H,32,38)(H2,30,31,37)/t14-,24-/m0/s1 |
| InChIKey | SKDCJPNZBBNRSG-BSEYFRJRSA-N |
| XLogP | 3.25 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|