C23H21F4N3O6S — CID 118957867
N-[(4-fluorophenyl)methyl]-2-(6-methoxy-1,1,2',5'-tetraoxospiro[2H-1-benzothiophene-3,4'-imidazolidine]-1'-yl)-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide (PubChem CID 118957867) has the molecular formula C23H21F4N3O6S and a molecular weight of 543.50 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-(6-methoxy-1,1,2',5'-tetraoxospiro[2H-1-benzothiophene-3,4'-imidazolidine]-1'-yl)-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-(6-methoxy-1,1,2',5'-tetraoxospiro[2H-1-benzothiophene-3,4'-imidazolidine]-1'-yl)-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
|---|---|
| PubChem CID | 118957867 |
| Molecular Formula | C23H21F4N3O6S |
| Molecular Weight | 543.50 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-(6-methoxy-1,1,2',5'-tetraoxospiro[2H-1-benzothiophene-3,4'-imidazolidine]-1'-yl)-N-[(2S)-1,1,1-trifluoropropan-2-yl]acetamide |
| SMILES | COc1ccc2c(c1)S(=O)(=O)CC21NC(=O)N(CC(=O)N(Cc2ccc(F)cc2)[C@@H](C)C(F)(F)F)C1=O |
| InChI | InChI=1S/C23H21F4N3O6S/c1-13(23(25,26)27)29(10-14-3-5-15(24)6-4-14)19(31)11-30-20(32)22(28-21(30)33)12-37(34,35)18-9-16(36-2)7-8-17(18)22/h3-9,13H,10-12H2,1-2H3,(H,28,33)/t13-,22?/m0/s1 |
| InChIKey | IJFYNCMYUPCHRT-JHAYDQECSA-N |
| XLogP | 2.35 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|