C21H22FN3O5 — CID 118958129
tert-butyl 2-[(1R,3S)-1-fluoro-6-(1-methylpyrazol-4-yl)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]acetate (PubChem CID 118958129) has the molecular formula C21H22FN3O5 and a molecular weight of 415.42 g/mol. Its IUPAC name is tert-butyl 2-[(1R,3S)-1-fluoro-6-(1-methylpyrazol-4-yl)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]acetate.
| Compound Name | tert-butyl 2-[(1R,3S)-1-fluoro-6-(1-methylpyrazol-4-yl)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]acetate |
|---|---|
| PubChem CID | 118958129 |
| Molecular Formula | C21H22FN3O5 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | tert-butyl 2-[(1R,3S)-1-fluoro-6-(1-methylpyrazol-4-yl)-2',4'-dioxospiro[1,2-dihydroindene-3,5'-1,3-oxazolidine]-3'-yl]acetate |
| SMILES | Cn1cc(-c2ccc3c(c2)[C@H](F)C[C@]32OC(=O)N(CC(=O)OC(C)(C)C)C2=O)cn1 |
| InChI | InChI=1S/C21H22FN3O5/c1-20(2,3)29-17(26)11-25-18(27)21(30-19(25)28)8-16(22)14-7-12(5-6-15(14)21)13-9-23-24(4)10-13/h5-7,9-10,16H,8,11H2,1-4H3/t16-,21+/m1/s1 |
| InChIKey | JGFSTRMELOOXOY-IERDGZPVSA-N |
| XLogP | 3.02 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |