C16H17N3O5 — CID 118958382
tert-butyl 2-(2,2',5'-trioxospiro[1H-indole-3,4'-imidazolidine]-1'-yl)acetate (PubChem CID 118958382) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is tert-butyl 2-(2,2',5'-trioxospiro[1H-indole-3,4'-imidazolidine]-1'-yl)acetate.
| Compound Name | tert-butyl 2-(2,2',5'-trioxospiro[1H-indole-3,4'-imidazolidine]-1'-yl)acetate |
|---|---|
| PubChem CID | 118958382 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | tert-butyl 2-(2,2',5'-trioxospiro[1H-indole-3,4'-imidazolidine]-1'-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)NC2(C(=O)Nc3ccccc32)C1=O |
| InChI | InChI=1S/C16H17N3O5/c1-15(2,3)24-11(20)8-19-13(22)16(18-14(19)23)9-6-4-5-7-10(9)17-12(16)21/h4-7H,8H2,1-3H3,(H,17,21)(H,18,23) |
| InChIKey | DSYIFZQCAUSXPP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|