C27H36N6O4 — CID 118958753
3-[methyl-[[3-[4-(oxan-4-ylcarbamoyl)-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl]phenyl]methyl]amino]propyl carbamate (PubChem CID 118958753) has the molecular formula C27H36N6O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is 3-[methyl-[[3-[4-(oxan-4-ylcarbamoyl)-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl]phenyl]methyl]amino]propyl carbamate.
| Compound Name | 3-[methyl-[[3-[4-(oxan-4-ylcarbamoyl)-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl]phenyl]methyl]amino]propyl carbamate |
|---|---|
| PubChem CID | 118958753 |
| Molecular Formula | C27H36N6O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | 3-[methyl-[[3-[4-(oxan-4-ylcarbamoyl)-1-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl]phenyl]methyl]amino]propyl carbamate |
| SMILES | CC(C)n1ncc2c(C(=O)NC3CCOCC3)cc(-c3cccc(CN(C)CCCOC(N)=O)c3)nc21 |
| InChI | InChI=1S/C27H36N6O4/c1-18(2)33-25-23(16-29-33)22(26(34)30-21-8-12-36-13-9-21)15-24(31-25)20-7-4-6-19(14-20)17-32(3)10-5-11-37-27(28)35/h4,6-7,14-16,18,21H,5,8-13,17H2,1-3H3,(H2,28,35)(H,30,34) |
| InChIKey | UXRVGZFFJBODCI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|