C16H15FN4O2S — CID 118958856
[3-(2,7-dimethyl-5-sulfanylidene-6,8-dihydropyrido[4,3-d]pyrimidin-7-yl)-4-fluorophenyl]carbamic acid (PubChem CID 118958856) has the molecular formula C16H15FN4O2S and a molecular weight of 346.39 g/mol. Its IUPAC name is [3-(2,7-dimethyl-5-sulfanylidene-6,8-dihydropyrido[4,3-d]pyrimidin-7-yl)-4-fluorophenyl]carbamic acid.
| Compound Name | [3-(2,7-dimethyl-5-sulfanylidene-6,8-dihydropyrido[4,3-d]pyrimidin-7-yl)-4-fluorophenyl]carbamic acid |
|---|---|
| PubChem CID | 118958856 |
| Molecular Formula | C16H15FN4O2S |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | [3-(2,7-dimethyl-5-sulfanylidene-6,8-dihydropyrido[4,3-d]pyrimidin-7-yl)-4-fluorophenyl]carbamic acid |
| SMILES | Cc1ncc2c(n1)CC(C)(c1cc(NC(=O)O)ccc1F)NC2=S |
| InChI | InChI=1S/C16H15FN4O2S/c1-8-18-7-10-13(19-8)6-16(2,21-14(10)24)11-5-9(20-15(22)23)3-4-12(11)17/h3-5,7,20H,6H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | SUTNQOMLTNNLIX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|