C17H11F2N3O2 — CID 118959076
4-(2,6-difluorobenzoyl)-N-pyridin-4-yl-1H-pyrrole-2-carboxamide (PubChem CID 118959076) has the molecular formula C17H11F2N3O2 and a molecular weight of 327.29 g/mol. Its IUPAC name is 4-(2,6-difluorobenzoyl)-N-pyridin-4-yl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-(2,6-difluorobenzoyl)-N-pyridin-4-yl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 118959076 |
| Molecular Formula | C17H11F2N3O2 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-(2,6-difluorobenzoyl)-N-pyridin-4-yl-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccncc1)c1cc(C(=O)c2c(F)cccc2F)c[nH]1 |
| InChI | InChI=1S/C17H11F2N3O2/c18-12-2-1-3-13(19)15(12)16(23)10-8-14(21-9-10)17(24)22-11-4-6-20-7-5-11/h1-9,21H,(H,20,22,24) |
| InChIKey | NWOBRTKSIRTTBB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |