About acetyl cyanide;3-bromo-2-(2-methoxyethoxy)pyridine
acetyl cyanide;3-bromo-2-(2-methoxyethoxy)pyridine (PubChem CID 118959757) has the molecular formula C11H13BrN2O3
and a molecular weight of 301.14 g/mol. Its IUPAC name is acetyl cyanide;3-bromo-2-(2-methoxyethoxy)pyridine.
Molecular Properties
| Compound Name | acetyl cyanide;3-bromo-2-(2-methoxyethoxy)pyridine |
| PubChem CID | 118959757 |
| Molecular Formula | C11H13BrN2O3 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | acetyl cyanide;3-bromo-2-(2-methoxyethoxy)pyridine |
| SMILES | CC(=O)C#N.COCCOc1ncccc1Br |
| InChI | InChI=1S/C8H10BrNO2.C3H3NO/c1-11-5-6-12-8-7(9)3-2-4-10-8;1-3(5)2-4/h2-4H,5-6H2,1H3;1H3 |
| InChIKey | JCAXLINLCRQNNZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetyl cyanide;3-bromo-2-(2-methoxyethoxy)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl cyanide;3-bromo-2-(2-methoxyethoxy)pyridine?
The IUPAC name of acetyl cyanide;3-bromo-2-(2-methoxyethoxy)pyridine (CID 118959757) is acetyl cyanide;3-bromo-2-(2-methoxyethoxy)pyridine.
What is the SMILES notation for acetyl cyanide;3-bromo-2-(2-methoxyethoxy)pyridine?
The canonical SMILES for acetyl cyanide;3-bromo-2-(2-methoxyethoxy)pyridine is CC(=O)C#N.COCCOc1ncccc1Br.
What is the InChIKey of acetyl cyanide;3-bromo-2-(2-methoxyethoxy)pyridine?
The InChIKey is JCAXLINLCRQNNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrNO2.C3H3NO/c1-11-5-6-12-8-7(9)3-2-4-10-8;1-3(5)2-4/h2-4H,5-6H2,1H3;1H3.
What are the key properties of acetyl cyanide;3-bromo-2-(2-methoxyethoxy)pyridine?
acetyl cyanide;3-bromo-2-(2-methoxyethoxy)pyridine has a molecular weight of 301.14 g/mol, XLogP of 1.97, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl cyanide;3-bromo-2-(2-methoxyethoxy)pyridine is sourced from PubChem (CID 118959757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).