C17H15N5O — CID 118959992
3-[(1-methylindazol-5-yl)methyl]-2H-indazole-5-carboxamide (PubChem CID 118959992) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is 3-[(1-methylindazol-5-yl)methyl]-2H-indazole-5-carboxamide.
| Compound Name | 3-[(1-methylindazol-5-yl)methyl]-2H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 118959992 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 3-[(1-methylindazol-5-yl)methyl]-2H-indazole-5-carboxamide |
| SMILES | Cn1ncc2cc(Cc3[nH]nc4ccc(C(N)=O)cc34)ccc21 |
| InChI | InChI=1S/C17H15N5O/c1-22-16-5-2-10(6-12(16)9-19-22)7-15-13-8-11(17(18)23)3-4-14(13)20-21-15/h2-6,8-9H,7H2,1H3,(H2,18,23)(H,20,21) |
| InChIKey | FKSZUWFVJWFYOD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |