C18H17N5O — CID 118960212
N-methyl-3-[(1-methylindazol-5-yl)methyl]-2H-indazole-5-carboxamide (PubChem CID 118960212) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is N-methyl-3-[(1-methylindazol-5-yl)methyl]-2H-indazole-5-carboxamide.
| Compound Name | N-methyl-3-[(1-methylindazol-5-yl)methyl]-2H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 118960212 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-methyl-3-[(1-methylindazol-5-yl)methyl]-2H-indazole-5-carboxamide |
| SMILES | CNC(=O)c1ccc2n[nH]c(Cc3ccc4c(cnn4C)c3)c2c1 |
| InChI | InChI=1S/C18H17N5O/c1-19-18(24)12-4-5-15-14(9-12)16(22-21-15)8-11-3-6-17-13(7-11)10-20-23(17)2/h3-7,9-10H,8H2,1-2H3,(H,19,24)(H,21,22) |
| InChIKey | ZKGWDQMQMQRGLJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |