C14H23F3N2 — CID 118960341
N,N'-dicyclohexyl-2,2,2-trifluoroethanimidamide (PubChem CID 118960341) has the molecular formula C14H23F3N2 and a molecular weight of 276.35 g/mol. Its IUPAC name is N,N'-dicyclohexyl-2,2,2-trifluoroethanimidamide.
| Compound Name | N,N'-dicyclohexyl-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 118960341 |
| Molecular Formula | C14H23F3N2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N,N'-dicyclohexyl-2,2,2-trifluoroethanimidamide |
| SMILES | FC(F)(F)/C(=N\C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C14H23F3N2/c15-14(16,17)13(18-11-7-3-1-4-8-11)19-12-9-5-2-6-10-12/h11-12H,1-10H2,(H,18,19) |
| InChIKey | RZFIRAIHOMZGNH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|