About 9-O-benzyl 6-O-ethyl 6-(2-oxoethyl)-1,4-dioxa-9-azaspiro[4.5]decane-6,9-dicarboxylate
9-O-benzyl 6-O-ethyl 6-(2-oxoethyl)-1,4-dioxa-9-azaspiro[4.5]decane-6,9-dicarboxylate (PubChem CID 118960370) has the molecular formula C20H25NO7
and a molecular weight of 391.42 g/mol. Its IUPAC name is 9-O-benzyl 6-O-ethyl 6-(2-oxoethyl)-1,4-dioxa-9-azaspiro[4.5]decane-6,9-dicarboxylate.
Molecular Properties
| Compound Name | 9-O-benzyl 6-O-ethyl 6-(2-oxoethyl)-1,4-dioxa-9-azaspiro[4.5]decane-6,9-dicarboxylate |
| PubChem CID | 118960370 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 9-O-benzyl 6-O-ethyl 6-(2-oxoethyl)-1,4-dioxa-9-azaspiro[4.5]decane-6,9-dicarboxylate |
| SMILES | CCOC(=O)C1(CC=O)CCN(C(=O)OCc2ccccc2)CC12OCCO2 |
| InChI | InChI=1S/C20H25NO7/c1-2-25-17(23)19(9-11-22)8-10-21(15-20(19)27-12-13-28-20)18(24)26-14-16-6-4-3-5-7-16/h3-7,11H,2,8-10,12-15H2,1H3 |
| InChIKey | DMLPKSCCRLJCEJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 9-O-benzyl 6-O-ethyl 6-(2-oxoethyl)-1,4-dioxa-9-azaspiro[4.5]decane-6,9-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-O-benzyl 6-O-ethyl 6-(2-oxoethyl)-1,4-dioxa-9-azaspiro[4.5]decane-6,9-dicarboxylate?
The IUPAC name of 9-O-benzyl 6-O-ethyl 6-(2-oxoethyl)-1,4-dioxa-9-azaspiro[4.5]decane-6,9-dicarboxylate (CID 118960370) is 9-O-benzyl 6-O-ethyl 6-(2-oxoethyl)-1,4-dioxa-9-azaspiro[4.5]decane-6,9-dicarboxylate.
What is the SMILES notation for 9-O-benzyl 6-O-ethyl 6-(2-oxoethyl)-1,4-dioxa-9-azaspiro[4.5]decane-6,9-dicarboxylate?
The canonical SMILES for 9-O-benzyl 6-O-ethyl 6-(2-oxoethyl)-1,4-dioxa-9-azaspiro[4.5]decane-6,9-dicarboxylate is CCOC(=O)C1(CC=O)CCN(C(=O)OCc2ccccc2)CC12OCCO2.
What is the InChIKey of 9-O-benzyl 6-O-ethyl 6-(2-oxoethyl)-1,4-dioxa-9-azaspiro[4.5]decane-6,9-dicarboxylate?
The InChIKey is DMLPKSCCRLJCEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO7/c1-2-25-17(23)19(9-11-22)8-10-21(15-20(19)27-12-13-28-20)18(24)26-14-16-6-4-3-5-7-16/h3-7,11H,2,8-10,12-15H2,1H3.
What are the key properties of 9-O-benzyl 6-O-ethyl 6-(2-oxoethyl)-1,4-dioxa-9-azaspiro[4.5]decane-6,9-dicarboxylate?
9-O-benzyl 6-O-ethyl 6-(2-oxoethyl)-1,4-dioxa-9-azaspiro[4.5]decane-6,9-dicarboxylate has a molecular weight of 391.42 g/mol, XLogP of 1.91, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-O-benzyl 6-O-ethyl 6-(2-oxoethyl)-1,4-dioxa-9-azaspiro[4.5]decane-6,9-dicarboxylate is sourced from PubChem (CID 118960370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).