About 3-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-4-phenoxybenzonitrile
3-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-4-phenoxybenzonitrile (PubChem CID 118960491) has the molecular formula C21H23N3O2
and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-4-phenoxybenzonitrile.
Molecular Properties
| Compound Name | 3-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-4-phenoxybenzonitrile |
| PubChem CID | 118960491 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 3-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-4-phenoxybenzonitrile |
| SMILES | N#Cc1ccc(Oc2ccccc2)c(N2CCC3(CC2)CNCCO3)c1 |
| InChI | InChI=1S/C21H23N3O2/c22-15-17-6-7-20(26-18-4-2-1-3-5-18)19(14-17)24-11-8-21(9-12-24)16-23-10-13-25-21/h1-7,14,23H,8-13,16H2 |
| InChIKey | SUAONMDAKPJEMZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-4-phenoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-4-phenoxybenzonitrile?
The IUPAC name of 3-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-4-phenoxybenzonitrile (CID 118960491) is 3-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-4-phenoxybenzonitrile.
What is the SMILES notation for 3-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-4-phenoxybenzonitrile?
The canonical SMILES for 3-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-4-phenoxybenzonitrile is N#Cc1ccc(Oc2ccccc2)c(N2CCC3(CC2)CNCCO3)c1.
What is the InChIKey of 3-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-4-phenoxybenzonitrile?
The InChIKey is SUAONMDAKPJEMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O2/c22-15-17-6-7-20(26-18-4-2-1-3-5-18)19(14-17)24-11-8-21(9-12-24)16-23-10-13-25-21/h1-7,14,23H,8-13,16H2.
What are the key properties of 3-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-4-phenoxybenzonitrile?
3-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-4-phenoxybenzonitrile has a molecular weight of 349.43 g/mol, XLogP of 3.31, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)-4-phenoxybenzonitrile is sourced from PubChem (CID 118960491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).