C21H30N6 — CID 118960949
N-[2-(4-aminophenyl)ethyl]-7-[3-(dimethylamino)propyl]-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 118960949) has the molecular formula C21H30N6 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-7-[3-(dimethylamino)propyl]-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-7-[3-(dimethylamino)propyl]-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 118960949 |
| Molecular Formula | C21H30N6 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-7-[3-(dimethylamino)propyl]-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1c(C)n(CCCN(C)C)c2ncnc(NCCc3ccc(N)cc3)c12 |
| InChI | InChI=1S/C21H30N6/c1-15-16(2)27(13-5-12-26(3)4)21-19(15)20(24-14-25-21)23-11-10-17-6-8-18(22)9-7-17/h6-9,14H,5,10-13,22H2,1-4H3,(H,23,24,25) |
| InChIKey | LHYRCCMXKOHFTR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|