About N-(6-bromo-2-pyridinyl)-2-[3,8-dimethyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide
N-(6-bromo-2-pyridinyl)-2-[3,8-dimethyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide (PubChem CID 118961050) has the molecular formula C17H17BrN6O4
and a molecular weight of 449.27 g/mol. Its IUPAC name is N-(6-bromo-2-pyridinyl)-2-[3,8-dimethyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide.
Molecular Properties
| Compound Name | N-(6-bromo-2-pyridinyl)-2-[3,8-dimethyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide |
| PubChem CID | 118961050 |
| Molecular Formula | C17H17BrN6O4 |
| Molecular Weight | 449.27 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | N-(6-bromo-2-pyridinyl)-2-[3,8-dimethyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide |
| SMILES | CC(=O)Cn1c(=O)c2c(nc(C)n2CC(=O)Nc2cccc(Br)n2)n(C)c1=O |
| InChI | InChI=1S/C17H17BrN6O4/c1-9(25)7-24-16(27)14-15(22(3)17(24)28)19-10(2)23(14)8-13(26)21-12-6-4-5-11(18)20-12/h4-6H,7-8H2,1-3H3,(H,20,21,26) |
| InChIKey | HXQRUMDZRWVPRQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-(6-bromo-2-pyridinyl)-2-[3,8-dimethyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-bromo-2-pyridinyl)-2-[3,8-dimethyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide?
The IUPAC name of N-(6-bromo-2-pyridinyl)-2-[3,8-dimethyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide (CID 118961050) is N-(6-bromo-2-pyridinyl)-2-[3,8-dimethyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide.
What is the SMILES notation for N-(6-bromo-2-pyridinyl)-2-[3,8-dimethyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide?
The canonical SMILES for N-(6-bromo-2-pyridinyl)-2-[3,8-dimethyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide is CC(=O)Cn1c(=O)c2c(nc(C)n2CC(=O)Nc2cccc(Br)n2)n(C)c1=O.
What is the InChIKey of N-(6-bromo-2-pyridinyl)-2-[3,8-dimethyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide?
The InChIKey is HXQRUMDZRWVPRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrN6O4/c1-9(25)7-24-16(27)14-15(22(3)17(24)28)19-10(2)23(14)8-13(26)21-12-6-4-5-11(18)20-12/h4-6H,7-8H2,1-3H3,(H,20,21,26).
What are the key properties of N-(6-bromo-2-pyridinyl)-2-[3,8-dimethyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide?
N-(6-bromo-2-pyridinyl)-2-[3,8-dimethyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide has a molecular weight of 449.27 g/mol, XLogP of 0.59, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-bromo-2-pyridinyl)-2-[3,8-dimethyl-2,6-dioxo-1-(2-oxopropyl)purin-7-yl]acetamide is sourced from PubChem (CID 118961050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).