C24H23F3N4 — CID 118961179
1,1-diphenyl-N-[6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-2-pyridinyl]methanimine (PubChem CID 118961179) has the molecular formula C24H23F3N4 and a molecular weight of 424.47 g/mol. Its IUPAC name is 1,1-diphenyl-N-[6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-2-pyridinyl]methanimine.
| Compound Name | 1,1-diphenyl-N-[6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-2-pyridinyl]methanimine |
|---|---|
| PubChem CID | 118961179 |
| Molecular Formula | C24H23F3N4 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1,1-diphenyl-N-[6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]-2-pyridinyl]methanimine |
| SMILES | FC(F)(F)CN1CCN(c2cccc(N=C(c3ccccc3)c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C24H23F3N4/c25-24(26,27)18-30-14-16-31(17-15-30)22-13-7-12-21(28-22)29-23(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-13H,14-18H2 |
| InChIKey | YWGSTSXEFFKYBC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|