About N-[2-[(3,5-difluoro-4-methoxyphenyl)methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide
N-[2-[(3,5-difluoro-4-methoxyphenyl)methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide (PubChem CID 118961993) has the molecular formula C21H19F2N5O2
and a molecular weight of 411.41 g/mol. Its IUPAC name is N-[2-[(3,5-difluoro-4-methoxyphenyl)methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-[2-[(3,5-difluoro-4-methoxyphenyl)methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide |
| PubChem CID | 118961993 |
| Molecular Formula | C21H19F2N5O2 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | N-[2-[(3,5-difluoro-4-methoxyphenyl)methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide |
| SMILES | COc1c(F)cc(Cn2ncc(NC(=O)Cc3ccc4c(ccn4C)c3)n2)cc1F |
| InChI | InChI=1S/C21H19F2N5O2/c1-27-6-5-15-7-13(3-4-18(15)27)10-20(29)25-19-11-24-28(26-19)12-14-8-16(22)21(30-2)17(23)9-14/h3-9,11H,10,12H2,1-2H3,(H,25,26,29) |
| InChIKey | CEZQTYVJVLAGKU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-[(3,5-difluoro-4-methoxyphenyl)methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(3,5-difluoro-4-methoxyphenyl)methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide?
The IUPAC name of N-[2-[(3,5-difluoro-4-methoxyphenyl)methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide (CID 118961993) is N-[2-[(3,5-difluoro-4-methoxyphenyl)methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide.
What is the SMILES notation for N-[2-[(3,5-difluoro-4-methoxyphenyl)methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide?
The canonical SMILES for N-[2-[(3,5-difluoro-4-methoxyphenyl)methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide is COc1c(F)cc(Cn2ncc(NC(=O)Cc3ccc4c(ccn4C)c3)n2)cc1F.
What is the InChIKey of N-[2-[(3,5-difluoro-4-methoxyphenyl)methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide?
The InChIKey is CEZQTYVJVLAGKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F2N5O2/c1-27-6-5-15-7-13(3-4-18(15)27)10-20(29)25-19-11-24-28(26-19)12-14-8-16(22)21(30-2)17(23)9-14/h3-9,11H,10,12H2,1-2H3,(H,25,26,29).
What are the key properties of N-[2-[(3,5-difluoro-4-methoxyphenyl)methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide?
N-[2-[(3,5-difluoro-4-methoxyphenyl)methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide has a molecular weight of 411.41 g/mol, XLogP of 3.29, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(3,5-difluoro-4-methoxyphenyl)methyl]triazol-4-yl]-2-(1-methylindol-5-yl)acetamide is sourced from PubChem (CID 118961993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).