C9H13F3N2 — CID 118962480
5-(2,2,2-trifluoroethyl)-1,2,3,4,6,7-hexahydropyrrolo[3,4-c]pyridine (PubChem CID 118962480) has the molecular formula C9H13F3N2 and a molecular weight of 206.21 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethyl)-1,2,3,4,6,7-hexahydropyrrolo[3,4-c]pyridine.
| Compound Name | 5-(2,2,2-trifluoroethyl)-1,2,3,4,6,7-hexahydropyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 118962480 |
| Molecular Formula | C9H13F3N2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 5-(2,2,2-trifluoroethyl)-1,2,3,4,6,7-hexahydropyrrolo[3,4-c]pyridine |
| SMILES | FC(F)(F)CN1CCC2=C(CNC2)C1 |
| InChI | InChI=1S/C9H13F3N2/c10-9(11,12)6-14-2-1-7-3-13-4-8(7)5-14/h13H,1-6H2 |
| InChIKey | OXLIJQJGXVKYRY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|