C31H30ClF2N7O2 — CID 118962738
N-(3-chloro-4-pyridinyl)-2-[1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]indazol-3-yl]-5-piperidin-4-ylpyrimidin-4-amine (PubChem CID 118962738) has the molecular formula C31H30ClF2N7O2 and a molecular weight of 606.08 g/mol. Its IUPAC name is N-(3-chloro-4-pyridinyl)-2-[1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]indazol-3-yl]-5-piperidin-4-ylpyrimidin-4-amine.
| Compound Name | N-(3-chloro-4-pyridinyl)-2-[1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]indazol-3-yl]-5-piperidin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 118962738 |
| Molecular Formula | C31H30ClF2N7O2 |
| Molecular Weight | 606.08 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | N-(3-chloro-4-pyridinyl)-2-[1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]indazol-3-yl]-5-piperidin-4-ylpyrimidin-4-amine |
| SMILES | COCCOc1cc(F)c(Cn2nc(-c3ncc(C4CCNCC4)c(Nc4ccncc4Cl)n3)c3ccccc32)c(F)c1 |
| InChI | InChI=1S/C31H30ClF2N7O2/c1-42-12-13-43-20-14-25(33)23(26(34)15-20)18-41-28-5-3-2-4-21(28)29(40-41)31-37-16-22(19-6-9-35-10-7-19)30(39-31)38-27-8-11-36-17-24(27)32/h2-5,8,11,14-17,19,35H,6-7,9-10,12-13,18H2,1H3,(H,36,37,38,39) |
| InChIKey | LEXYYVUKVANWHO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.08 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|