C21H17FN6O4 — CID 118962822
methyl 3-[[2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]-3-oxopropanoate (PubChem CID 118962822) has the molecular formula C21H17FN6O4 and a molecular weight of 436.40 g/mol. Its IUPAC name is methyl 3-[[2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]-3-oxopropanoate.
| Compound Name | methyl 3-[[2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 118962822 |
| Molecular Formula | C21H17FN6O4 |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | methyl 3-[[2-[1-[(2-fluorophenyl)methyl]-5-(1,2-oxazol-3-yl)pyrazol-3-yl]pyrimidin-4-yl]amino]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)Nc1ccnc(-c2cc(-c3ccon3)n(Cc3ccccc3F)n2)n1 |
| InChI | InChI=1S/C21H17FN6O4/c1-31-20(30)11-19(29)24-18-6-8-23-21(25-18)16-10-17(15-7-9-32-27-15)28(26-16)12-13-4-2-3-5-14(13)22/h2-10H,11-12H2,1H3,(H,23,24,25,29) |
| InChIKey | RUIPWFSJXDRPDI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|