C28H28F2N2O2 — CID 118962932
8-benzyl-2-[bis(4-fluorophenyl)methyl]-6-hydroxy-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 118962932) has the molecular formula C28H28F2N2O2 and a molecular weight of 462.54 g/mol. Its IUPAC name is 8-benzyl-2-[bis(4-fluorophenyl)methyl]-6-hydroxy-2,8-diazaspiro[4.5]decan-1-one.
| Compound Name | 8-benzyl-2-[bis(4-fluorophenyl)methyl]-6-hydroxy-2,8-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 118962932 |
| Molecular Formula | C28H28F2N2O2 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 8-benzyl-2-[bis(4-fluorophenyl)methyl]-6-hydroxy-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | O=C1N(C(c2ccc(F)cc2)c2ccc(F)cc2)CCC12CCN(Cc1ccccc1)CC2O |
| InChI | InChI=1S/C28H28F2N2O2/c29-23-10-6-21(7-11-23)26(22-8-12-24(30)13-9-22)32-17-15-28(27(32)34)14-16-31(19-25(28)33)18-20-4-2-1-3-5-20/h1-13,25-26,33H,14-19H2 |
| InChIKey | JUXGVZMSAQQLLN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |