C11H12Cl4O2 — CID 118963173
2,2,4,4-tetrachloro-1,5-diethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 118963173) has the molecular formula C11H12Cl4O2 and a molecular weight of 318.03 g/mol. Its IUPAC name is 2,2,4,4-tetrachloro-1,5-diethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | 2,2,4,4-tetrachloro-1,5-diethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 118963173 |
| Molecular Formula | C11H12Cl4O2 |
| Molecular Weight | 318.03 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | 2,2,4,4-tetrachloro-1,5-diethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CCC12C=CC(CC)(O1)C(Cl)(Cl)C(=O)C2(Cl)Cl |
| InChI | InChI=1S/C11H12Cl4O2/c1-3-8-5-6-9(4-2,17-8)11(14,15)7(16)10(8,12)13/h5-6H,3-4H2,1-2H3 |
| InChIKey | MCWHQTSJTCOCMX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.03 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|