C5H7N3S2 — CID 118963300
6-ethylidene-1,3,5-triazinane-2,4-dithione (PubChem CID 118963300) has the molecular formula C5H7N3S2 and a molecular weight of 173.27 g/mol. Its IUPAC name is 6-ethylidene-1,3,5-triazinane-2,4-dithione.
| Compound Name | 6-ethylidene-1,3,5-triazinane-2,4-dithione |
|---|---|
| PubChem CID | 118963300 |
| Molecular Formula | C5H7N3S2 |
| Molecular Weight | 173.27 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | 6-ethylidene-1,3,5-triazinane-2,4-dithione |
| SMILES | CC=C1NC(=S)NC(=S)N1 |
| InChI | InChI=1S/C5H7N3S2/c1-2-3-6-4(9)8-5(10)7-3/h2H,1H3,(H3,6,7,8,9,10) |
| InChIKey | ZOMNPPRWNNMFGG-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|