C32H47NO4 — CID 118963546
trans-methyl (1S,4S)-4-[(1Z,2S,4aS,8aR)-7-cyano-2,8a-dimethyl-6-oxo-1-(2-oxopropylidene)-3,4,4a,5-tetrahydronaphthalen-2-yl]-1,4,8,8-tetramethylcyclodecane-1-carboxylate (PubChem CID 118963546) has the molecular formula C32H47NO4 and a molecular weight of 509.73 g/mol. Its IUPAC name is trans-methyl (1S,4S)-4-[(1Z,2S,4aS,8aR)-7-cyano-2,8a-dimethyl-6-oxo-1-(2-oxopropylidene)-3,4,4a,5-tetrahydronaphthalen-2-yl]-1,4,8,8-tetramethylcyclodecane-1-carboxylate.
| Compound Name | trans-methyl (1S,4S)-4-[(1Z,2S,4aS,8aR)-7-cyano-2,8a-dimethyl-6-oxo-1-(2-oxopropylidene)-3,4,4a,5-tetrahydronaphthalen-2-yl]-1,4,8,8-tetramethylcyclodecane-1-carboxylate |
|---|---|
| PubChem CID | 118963546 |
| Molecular Formula | C32H47NO4 |
| Molecular Weight | 509.73 g/mol |
| Exact Mass | 509.35 |
| IUPAC Name | trans-methyl (1S,4S)-4-[(1Z,2S,4aS,8aR)-7-cyano-2,8a-dimethyl-6-oxo-1-(2-oxopropylidene)-3,4,4a,5-tetrahydronaphthalen-2-yl]-1,4,8,8-tetramethylcyclodecane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CCC(C)(C)CCC[C@](C)([C@]2(C)CC[C@H]3CC(=O)C(C#N)=C[C@]3(C)/C2=C/C(C)=O)CC1 |
| InChI | InChI=1S/C32H47NO4/c1-22(34)18-26-31(6)20-23(21-33)25(35)19-24(31)10-13-32(26,7)30(5)12-9-11-28(2,3)14-15-29(4,16-17-30)27(36)37-8/h18,20,24H,9-17,19H2,1-8H3/b26-18-/t24-,29-,30-,31-,32+/m0/s1 |
| InChIKey | KORALHNQKLAODY-PZDBIYARSA-N |
| XLogP | 7.30 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.73 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|