C7H13N5 — CID 118964216
4-ethenyl-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine (PubChem CID 118964216) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is 4-ethenyl-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine.
| Compound Name | 4-ethenyl-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 118964216 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 4-ethenyl-6-N,6-N-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
| SMILES | C=CC1N=C(N)NC(N(C)C)=N1 |
| InChI | InChI=1S/C7H13N5/c1-4-5-9-6(8)11-7(10-5)12(2)3/h4-5H,1H2,2-3H3,(H3,8,9,10,11) |
| InChIKey | TUCDZRIDHZMKDY-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|