About 4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholine
4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholine (PubChem CID 118964267) has the molecular formula C11H17N3OS
and a molecular weight of 239.34 g/mol. Its IUPAC name is 4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholine.
Molecular Properties
| Compound Name | 4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholine |
| PubChem CID | 118964267 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholine |
| SMILES | CN1CCc2nc(N3CCOCC3)sc2C1 |
| InChI | InChI=1S/C11H17N3OS/c1-13-3-2-9-10(8-13)16-11(12-9)14-4-6-15-7-5-14/h2-8H2,1H3 |
| InChIKey | IQZYFEGDMDBWTG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholine?
The IUPAC name of 4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholine (CID 118964267) is 4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholine.
What is the SMILES notation for 4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholine?
The canonical SMILES for 4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholine is CN1CCc2nc(N3CCOCC3)sc2C1.
What is the InChIKey of 4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholine?
The InChIKey is IQZYFEGDMDBWTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3OS/c1-13-3-2-9-10(8-13)16-11(12-9)14-4-6-15-7-5-14/h2-8H2,1H3.
What are the key properties of 4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholine?
4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholine has a molecular weight of 239.34 g/mol, XLogP of 0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)morpholine is sourced from PubChem (CID 118964267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).