About 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-amine
4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-amine (PubChem CID 118964286) has the molecular formula C8H15N5O
and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-amine.
Molecular Properties
| Compound Name | 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-amine |
| PubChem CID | 118964286 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-amine |
| SMILES | CCc1nnc(N2CCN(N)CC2)o1 |
| InChI | InChI=1S/C8H15N5O/c1-2-7-10-11-8(14-7)12-3-5-13(9)6-4-12/h2-6,9H2,1H3 |
| InChIKey | QLSNVNAKXHMWJE-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-amine?
The IUPAC name of 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-amine (CID 118964286) is 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-amine.
What is the SMILES notation for 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-amine?
The canonical SMILES for 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-amine is CCc1nnc(N2CCN(N)CC2)o1.
What is the InChIKey of 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-amine?
The InChIKey is QLSNVNAKXHMWJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N5O/c1-2-7-10-11-8(14-7)12-3-5-13(9)6-4-12/h2-6,9H2,1H3.
What are the key properties of 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-amine?
4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-amine has a molecular weight of 197.24 g/mol, XLogP of -0.37, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-ethyl-1,3,4-oxadiazol-2-yl)piperazin-1-amine is sourced from PubChem (CID 118964286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).