About N-[(2R)-1-(5,5-dimethylcyclohexen-1-yl)-1-hydroxy-3-methylbutan-2-yl]-4-methylpentanamide
N-[(2R)-1-(5,5-dimethylcyclohexen-1-yl)-1-hydroxy-3-methylbutan-2-yl]-4-methylpentanamide (PubChem CID 118964469) has the molecular formula C19H35NO2
and a molecular weight of 309.49 g/mol. Its IUPAC name is N-[(2R)-1-(5,5-dimethylcyclohexen-1-yl)-1-hydroxy-3-methylbutan-2-yl]-4-methylpentanamide.
Molecular Properties
| Compound Name | N-[(2R)-1-(5,5-dimethylcyclohexen-1-yl)-1-hydroxy-3-methylbutan-2-yl]-4-methylpentanamide |
| PubChem CID | 118964469 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | N-[(2R)-1-(5,5-dimethylcyclohexen-1-yl)-1-hydroxy-3-methylbutan-2-yl]-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)N[C@H](C(C)C)C(O)C1=CCCC(C)(C)C1 |
| InChI | InChI=1S/C19H35NO2/c1-13(2)9-10-16(21)20-17(14(3)4)18(22)15-8-7-11-19(5,6)12-15/h8,13-14,17-18,22H,7,9-12H2,1-6H3,(H,20,21)/t17-,18?/m1/s1 |
| InChIKey | SQEJCJXOESMFDG-QNSVNVJESA-N |
| XLogP | 4.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R)-1-(5,5-dimethylcyclohexen-1-yl)-1-hydroxy-3-methylbutan-2-yl]-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-1-(5,5-dimethylcyclohexen-1-yl)-1-hydroxy-3-methylbutan-2-yl]-4-methylpentanamide?
The IUPAC name of N-[(2R)-1-(5,5-dimethylcyclohexen-1-yl)-1-hydroxy-3-methylbutan-2-yl]-4-methylpentanamide (CID 118964469) is N-[(2R)-1-(5,5-dimethylcyclohexen-1-yl)-1-hydroxy-3-methylbutan-2-yl]-4-methylpentanamide.
What is the SMILES notation for N-[(2R)-1-(5,5-dimethylcyclohexen-1-yl)-1-hydroxy-3-methylbutan-2-yl]-4-methylpentanamide?
The canonical SMILES for N-[(2R)-1-(5,5-dimethylcyclohexen-1-yl)-1-hydroxy-3-methylbutan-2-yl]-4-methylpentanamide is CC(C)CCC(=O)N[C@H](C(C)C)C(O)C1=CCCC(C)(C)C1.
What is the InChIKey of N-[(2R)-1-(5,5-dimethylcyclohexen-1-yl)-1-hydroxy-3-methylbutan-2-yl]-4-methylpentanamide?
The InChIKey is SQEJCJXOESMFDG-QNSVNVJESA-N. The full InChI is InChI=1S/C19H35NO2/c1-13(2)9-10-16(21)20-17(14(3)4)18(22)15-8-7-11-19(5,6)12-15/h8,13-14,17-18,22H,7,9-12H2,1-6H3,(H,20,21)/t17-,18?/m1/s1.
What are the key properties of N-[(2R)-1-(5,5-dimethylcyclohexen-1-yl)-1-hydroxy-3-methylbutan-2-yl]-4-methylpentanamide?
N-[(2R)-1-(5,5-dimethylcyclohexen-1-yl)-1-hydroxy-3-methylbutan-2-yl]-4-methylpentanamide has a molecular weight of 309.49 g/mol, XLogP of 4.06, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-1-(5,5-dimethylcyclohexen-1-yl)-1-hydroxy-3-methylbutan-2-yl]-4-methylpentanamide is sourced from PubChem (CID 118964469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).