C20H40N2O2 — CID 118964477
1-[[4-[hydroxy-[[(2S)-2,4,4-trimethyloctyl]amino]methyl]cyclohex-3-en-1-yl]amino]ethanol (PubChem CID 118964477) has the molecular formula C20H40N2O2 and a molecular weight of 340.55 g/mol. Its IUPAC name is 1-[[4-[hydroxy-[[(2S)-2,4,4-trimethyloctyl]amino]methyl]cyclohex-3-en-1-yl]amino]ethanol.
| Compound Name | 1-[[4-[hydroxy-[[(2S)-2,4,4-trimethyloctyl]amino]methyl]cyclohex-3-en-1-yl]amino]ethanol |
|---|---|
| PubChem CID | 118964477 |
| Molecular Formula | C20H40N2O2 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | 1-[[4-[hydroxy-[[(2S)-2,4,4-trimethyloctyl]amino]methyl]cyclohex-3-en-1-yl]amino]ethanol |
| SMILES | CCCCC(C)(C)C[C@H](C)CNC(O)C1=CCC(NC(C)O)CC1 |
| InChI | InChI=1S/C20H40N2O2/c1-6-7-12-20(4,5)13-15(2)14-21-19(24)17-8-10-18(11-9-17)22-16(3)23/h8,15-16,18-19,21-24H,6-7,9-14H2,1-5H3/t15-,16?,18?,19?/m0/s1 |
| InChIKey | DTEWSPSHIDDPGB-HXQJQUPVSA-N |
| XLogP | 3.54 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|