About (4S)-6-(1,1-difluoroethoxy)-4-ethyl-2-methylocta-1,7-diene
(4S)-6-(1,1-difluoroethoxy)-4-ethyl-2-methylocta-1,7-diene (PubChem CID 118964537) has the molecular formula C13H22F2O
and a molecular weight of 232.31 g/mol. Its IUPAC name is (4S)-6-(1,1-difluoroethoxy)-4-ethyl-2-methylocta-1,7-diene.
Molecular Properties
| Compound Name | (4S)-6-(1,1-difluoroethoxy)-4-ethyl-2-methylocta-1,7-diene |
| PubChem CID | 118964537 |
| Molecular Formula | C13H22F2O |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (4S)-6-(1,1-difluoroethoxy)-4-ethyl-2-methylocta-1,7-diene |
| SMILES | C=CC(C[C@@H](CC)CC(=C)C)OC(C)(F)F |
| InChI | InChI=1S/C13H22F2O/c1-6-11(8-10(3)4)9-12(7-2)16-13(5,14)15/h7,11-12H,2-3,6,8-9H2,1,4-5H3/t11-,12?/m0/s1 |
| InChIKey | GOOKHZDESVMIQS-PXYINDEMSA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-6-(1,1-difluoroethoxy)-4-ethyl-2-methylocta-1,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-6-(1,1-difluoroethoxy)-4-ethyl-2-methylocta-1,7-diene?
The IUPAC name of (4S)-6-(1,1-difluoroethoxy)-4-ethyl-2-methylocta-1,7-diene (CID 118964537) is (4S)-6-(1,1-difluoroethoxy)-4-ethyl-2-methylocta-1,7-diene.
What is the SMILES notation for (4S)-6-(1,1-difluoroethoxy)-4-ethyl-2-methylocta-1,7-diene?
The canonical SMILES for (4S)-6-(1,1-difluoroethoxy)-4-ethyl-2-methylocta-1,7-diene is C=CC(C[C@@H](CC)CC(=C)C)OC(C)(F)F.
What is the InChIKey of (4S)-6-(1,1-difluoroethoxy)-4-ethyl-2-methylocta-1,7-diene?
The InChIKey is GOOKHZDESVMIQS-PXYINDEMSA-N. The full InChI is InChI=1S/C13H22F2O/c1-6-11(8-10(3)4)9-12(7-2)16-13(5,14)15/h7,11-12H,2-3,6,8-9H2,1,4-5H3/t11-,12?/m0/s1.
What are the key properties of (4S)-6-(1,1-difluoroethoxy)-4-ethyl-2-methylocta-1,7-diene?
(4S)-6-(1,1-difluoroethoxy)-4-ethyl-2-methylocta-1,7-diene has a molecular weight of 232.31 g/mol, XLogP of 4.55, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-6-(1,1-difluoroethoxy)-4-ethyl-2-methylocta-1,7-diene is sourced from PubChem (CID 118964537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).