About S-[2-methyl-1-(2-methyl-1-sulfanylpropan-2-yl)oxypropan-2-yl] 2,2-dimethylpropanethioate
S-[2-methyl-1-(2-methyl-1-sulfanylpropan-2-yl)oxypropan-2-yl] 2,2-dimethylpropanethioate (PubChem CID 118964728) has the molecular formula C13H26O2S2
and a molecular weight of 278.48 g/mol. Its IUPAC name is S-[2-methyl-1-(2-methyl-1-sulfanylpropan-2-yl)oxypropan-2-yl] 2,2-dimethylpropanethioate.
Molecular Properties
| Compound Name | S-[2-methyl-1-(2-methyl-1-sulfanylpropan-2-yl)oxypropan-2-yl] 2,2-dimethylpropanethioate |
| PubChem CID | 118964728 |
| Molecular Formula | C13H26O2S2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | S-[2-methyl-1-(2-methyl-1-sulfanylpropan-2-yl)oxypropan-2-yl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)(CS)OCC(C)(C)SC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H26O2S2/c1-11(2,3)10(14)17-13(6,7)8-15-12(4,5)9-16/h16H,8-9H2,1-7H3 |
| InChIKey | GDEFJAIMCAACDS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze S-[2-methyl-1-(2-methyl-1-sulfanylpropan-2-yl)oxypropan-2-yl] 2,2-dimethylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-methyl-1-(2-methyl-1-sulfanylpropan-2-yl)oxypropan-2-yl] 2,2-dimethylpropanethioate?
The IUPAC name of S-[2-methyl-1-(2-methyl-1-sulfanylpropan-2-yl)oxypropan-2-yl] 2,2-dimethylpropanethioate (CID 118964728) is S-[2-methyl-1-(2-methyl-1-sulfanylpropan-2-yl)oxypropan-2-yl] 2,2-dimethylpropanethioate.
What is the SMILES notation for S-[2-methyl-1-(2-methyl-1-sulfanylpropan-2-yl)oxypropan-2-yl] 2,2-dimethylpropanethioate?
The canonical SMILES for S-[2-methyl-1-(2-methyl-1-sulfanylpropan-2-yl)oxypropan-2-yl] 2,2-dimethylpropanethioate is CC(C)(CS)OCC(C)(C)SC(=O)C(C)(C)C.
What is the InChIKey of S-[2-methyl-1-(2-methyl-1-sulfanylpropan-2-yl)oxypropan-2-yl] 2,2-dimethylpropanethioate?
The InChIKey is GDEFJAIMCAACDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2S2/c1-11(2,3)10(14)17-13(6,7)8-15-12(4,5)9-16/h16H,8-9H2,1-7H3.
What are the key properties of S-[2-methyl-1-(2-methyl-1-sulfanylpropan-2-yl)oxypropan-2-yl] 2,2-dimethylpropanethioate?
S-[2-methyl-1-(2-methyl-1-sulfanylpropan-2-yl)oxypropan-2-yl] 2,2-dimethylpropanethioate has a molecular weight of 278.48 g/mol, XLogP of 3.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-methyl-1-(2-methyl-1-sulfanylpropan-2-yl)oxypropan-2-yl] 2,2-dimethylpropanethioate is sourced from PubChem (CID 118964728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).