C23H22NO+ — CID 11896518
(2S,3S,3aR,9bR)-2,3-diphenyl-1,2,3,3a,4,9b-hexahydrochromeno[4,3-b]pyrrol-1-ium (PubChem CID 11896518) has the molecular formula C23H22NO+ and a molecular weight of 328.44 g/mol. Its IUPAC name is (2S,3S,3aR,9bR)-2,3-diphenyl-1,2,3,3a,4,9b-hexahydrochromeno[4,3-b]pyrrol-1-ium.
| Compound Name | (2S,3S,3aR,9bR)-2,3-diphenyl-1,2,3,3a,4,9b-hexahydrochromeno[4,3-b]pyrrol-1-ium |
|---|---|
| PubChem CID | 11896518 |
| Molecular Formula | C23H22NO+ |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (2S,3S,3aR,9bR)-2,3-diphenyl-1,2,3,3a,4,9b-hexahydrochromeno[4,3-b]pyrrol-1-ium |
| SMILES | c1ccc([C@@H]2[C@H]3COc4ccccc4[C@@H]3[NH2+][C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO/c1-3-9-16(10-4-1)21-19-15-25-20-14-8-7-13-18(20)23(19)24-22(21)17-11-5-2-6-12-17/h1-14,19,21-24H,15H2/p+1/t19-,21-,22-,23+/m1/s1 |
| InChIKey | RCYAVNHQXWBEAI-ADHNFCLRSA-O |
| XLogP | 3.84 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |