C40H58N12O2 — CID 118965434
(2R)-2-amino-N-benzyl-5-[4-[[2-[[1-[3-[3-(cyclohexylamino)propylamino]propyl]triazol-4-yl]methylamino]quinazolin-4-yl]amino]piperidin-1-yl]-5-oxopentanamide (PubChem CID 118965434) has the molecular formula C40H58N12O2 and a molecular weight of 738.99 g/mol. Its IUPAC name is (2R)-2-amino-N-benzyl-5-[4-[[2-[[1-[3-[3-(cyclohexylamino)propylamino]propyl]triazol-4-yl]methylamino]quinazolin-4-yl]amino]piperidin-1-yl]-5-oxopentanamide.
| Compound Name | (2R)-2-amino-N-benzyl-5-[4-[[2-[[1-[3-[3-(cyclohexylamino)propylamino]propyl]triazol-4-yl]methylamino]quinazolin-4-yl]amino]piperidin-1-yl]-5-oxopentanamide |
|---|---|
| PubChem CID | 118965434 |
| Molecular Formula | C40H58N12O2 |
| Molecular Weight | 738.99 g/mol |
| Exact Mass | 738.48 |
| IUPAC Name | (2R)-2-amino-N-benzyl-5-[4-[[2-[[1-[3-[3-(cyclohexylamino)propylamino]propyl]triazol-4-yl]methylamino]quinazolin-4-yl]amino]piperidin-1-yl]-5-oxopentanamide |
| SMILES | N[C@H](CCC(=O)N1CCC(Nc2nc(NCc3cn(CCCNCCCNC4CCCCC4)nn3)nc3ccccc23)CC1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C40H58N12O2/c41-35(39(54)44-27-30-11-3-1-4-12-30)17-18-37(53)51-25-19-32(20-26-51)46-38-34-15-7-8-16-36(34)47-40(48-38)45-28-33-29-52(50-49-33)24-10-22-42-21-9-23-43-31-13-5-2-6-14-31/h1,3-4,7-8,11-12,15-16,29,31-32,35,42-43H,2,5-6,9-10,13-14,17-28,41H2,(H,44,54)(H2,45,46,47,48)/t35-/m1/s1 |
| InChIKey | XEPCQWUJHYHAFS-PGUFJCEWSA-N |
| XLogP | 3.95 |
| TPSA | 180.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.99 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|