C23H22N4O3 — CID 118965502
1-[2-[[3-(4-methoxyphenyl)phenoxy]methyl]-3-methylphenyl]-4-methyltetrazol-5-one (PubChem CID 118965502) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 1-[2-[[3-(4-methoxyphenyl)phenoxy]methyl]-3-methylphenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-[[3-(4-methoxyphenyl)phenoxy]methyl]-3-methylphenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 118965502 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-[2-[[3-(4-methoxyphenyl)phenoxy]methyl]-3-methylphenyl]-4-methyltetrazol-5-one |
| SMILES | COc1ccc(-c2cccc(OCc3c(C)cccc3-n3nnn(C)c3=O)c2)cc1 |
| InChI | InChI=1S/C23H22N4O3/c1-16-6-4-9-22(27-23(28)26(2)24-25-27)21(16)15-30-20-8-5-7-18(14-20)17-10-12-19(29-3)13-11-17/h4-14H,15H2,1-3H3 |
| InChIKey | OFLPHWLLKIBXFJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |