C23H24FNO6S — CID 118965594
methyl (1aR,7bS)-5-[[2-(2,2-dimethyl-3-oxopropyl)-4-fluorophenyl]sulfonylamino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromene-4-carboxylate (PubChem CID 118965594) has the molecular formula C23H24FNO6S and a molecular weight of 461.51 g/mol. Its IUPAC name is methyl (1aR,7bS)-5-[[2-(2,2-dimethyl-3-oxopropyl)-4-fluorophenyl]sulfonylamino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromene-4-carboxylate.
| Compound Name | methyl (1aR,7bS)-5-[[2-(2,2-dimethyl-3-oxopropyl)-4-fluorophenyl]sulfonylamino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromene-4-carboxylate |
|---|---|
| PubChem CID | 118965594 |
| Molecular Formula | C23H24FNO6S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | methyl (1aR,7bS)-5-[[2-(2,2-dimethyl-3-oxopropyl)-4-fluorophenyl]sulfonylamino]-1,1a,2,7b-tetrahydrocyclopropa[c]chromene-4-carboxylate |
| SMILES | COC(=O)c1c(NS(=O)(=O)c2ccc(F)cc2CC(C)(C)C=O)ccc2c1OC[C@@H]1C[C@H]21 |
| InChI | InChI=1S/C23H24FNO6S/c1-23(2,12-26)10-13-8-15(24)4-7-19(13)32(28,29)25-18-6-5-16-17-9-14(17)11-31-21(16)20(18)22(27)30-3/h4-8,12,14,17,25H,9-11H2,1-3H3/t14-,17-/m0/s1 |
| InChIKey | YGLSGGAYNSZPPM-YOEHRIQHSA-N |
| XLogP | 3.68 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|